C15H16N4O2 — CID 82563006
5,6-dimethoxy-N-(pyridin-3-ylmethyl)-1H-benzimidazol-2-amine (PubChem CID 82563006) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 5,6-dimethoxy-N-(pyridin-3-ylmethyl)-1H-benzimidazol-2-amine.
| Compound Name | 5,6-dimethoxy-N-(pyridin-3-ylmethyl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 82563006 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 5,6-dimethoxy-N-(pyridin-3-ylmethyl)-1H-benzimidazol-2-amine |
| SMILES | COc1cc2nc(NCc3cccnc3)[nH]c2cc1OC |
| InChI | InChI=1S/C15H16N4O2/c1-20-13-6-11-12(7-14(13)21-2)19-15(18-11)17-9-10-4-3-5-16-8-10/h3-8H,9H2,1-2H3,(H2,17,18,19) |
| InChIKey | ZEOCTCYWNIJIIS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |