About N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine
N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine (PubChem CID 591998) has the molecular formula C21H20N4O2
and a molecular weight of 360.42 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine.
Molecular Properties
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine |
| PubChem CID | 591998 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine |
| SMILES | COc1ccc(CNc2ccc3nc(-c4cccnc4)[nH]c3c2)cc1OC |
| InChI | InChI=1S/C21H20N4O2/c1-26-19-8-5-14(10-20(19)27-2)12-23-16-6-7-17-18(11-16)25-21(24-17)15-4-3-9-22-13-15/h3-11,13,23H,12H2,1-2H3,(H,24,25) |
| InChIKey | LIWOLOITJRTBAM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine?
The IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine (CID 591998) is N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine.
What is the SMILES notation for N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine?
The canonical SMILES for N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine is COc1ccc(CNc2ccc3nc(-c4cccnc4)[nH]c3c2)cc1OC.
What is the InChIKey of N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine?
The InChIKey is LIWOLOITJRTBAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O2/c1-26-19-8-5-14(10-20(19)27-2)12-23-16-6-7-17-18(11-16)25-21(24-17)15-4-3-9-22-13-15/h3-11,13,23H,12H2,1-2H3,(H,24,25).
What are the key properties of N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine?
N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine has a molecular weight of 360.42 g/mol, XLogP of 4.25, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dimethoxyphenyl)methyl]-2-pyridin-3-yl-3H-benzimidazol-5-amine is sourced from PubChem (CID 591998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).