C18H22N3O2+ — CID 51373449
N-[(3,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3H-benzimidazol-1-ium-5-amine (PubChem CID 51373449) has the molecular formula C18H22N3O2+ and a molecular weight of 312.39 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3H-benzimidazol-1-ium-5-amine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3H-benzimidazol-1-ium-5-amine |
|---|---|
| PubChem CID | 51373449 |
| Molecular Formula | C18H22N3O2+ |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-1,2-dimethyl-3H-benzimidazol-1-ium-5-amine |
| SMILES | COc1ccc(CNc2ccc3c(c2)[nH]c(C)[n+]3C)cc1OC |
| InChI | InChI=1S/C18H21N3O2/c1-12-20-15-10-14(6-7-16(15)21(12)2)19-11-13-5-8-17(22-3)18(9-13)23-4/h5-10,19H,11H2,1-4H3/p+1 |
| InChIKey | GAHJUOIVAKWIIW-UHFFFAOYSA-O |
| XLogP | 2.93 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|