C17H20N3O+ — CID 51373666
N-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3H-benzimidazol-1-ium-5-amine (PubChem CID 51373666) has the molecular formula C17H20N3O+ and a molecular weight of 282.37 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3H-benzimidazol-1-ium-5-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3H-benzimidazol-1-ium-5-amine |
|---|---|
| PubChem CID | 51373666 |
| Molecular Formula | C17H20N3O+ |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3H-benzimidazol-1-ium-5-amine |
| SMILES | COc1ccc(CNc2ccc3c(c2)[nH]c(C)[n+]3C)cc1 |
| InChI | InChI=1S/C17H19N3O/c1-12-19-16-10-14(6-9-17(16)20(12)2)18-11-13-4-7-15(21-3)8-5-13/h4-10,18H,11H2,1-3H3/p+1 |
| InChIKey | JXCZXKMJBLPFEY-UHFFFAOYSA-O |
| XLogP | 2.92 |
| TPSA | 40.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|