C18H22N3O+ — CID 51373455
N-[(4-ethoxyphenyl)methyl]-1,2-dimethyl-3H-benzimidazol-1-ium-5-amine (PubChem CID 51373455) has the molecular formula C18H22N3O+ and a molecular weight of 296.39 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)methyl]-1,2-dimethyl-3H-benzimidazol-1-ium-5-amine.
| Compound Name | N-[(4-ethoxyphenyl)methyl]-1,2-dimethyl-3H-benzimidazol-1-ium-5-amine |
|---|---|
| PubChem CID | 51373455 |
| Molecular Formula | C18H22N3O+ |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | N-[(4-ethoxyphenyl)methyl]-1,2-dimethyl-3H-benzimidazol-1-ium-5-amine |
| SMILES | CCOc1ccc(CNc2ccc3c(c2)[nH]c(C)[n+]3C)cc1 |
| InChI | InChI=1S/C18H21N3O/c1-4-22-16-8-5-14(6-9-16)12-19-15-7-10-18-17(11-15)20-13(2)21(18)3/h5-11,19H,4,12H2,1-3H3/p+1 |
| InChIKey | VGXKZZJKZUGZQX-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 40.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|