C16H15BrN2O2 — CID 107275958
2-bromo-4-[(3,4-dimethoxyphenyl)methylamino]benzonitrile (PubChem CID 107275958) has the molecular formula C16H15BrN2O2 and a molecular weight of 347.21 g/mol. Its IUPAC name is 2-bromo-4-[(3,4-dimethoxyphenyl)methylamino]benzonitrile.
| Compound Name | 2-bromo-4-[(3,4-dimethoxyphenyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 107275958 |
| Molecular Formula | C16H15BrN2O2 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2-bromo-4-[(3,4-dimethoxyphenyl)methylamino]benzonitrile |
| SMILES | COc1ccc(CNc2ccc(C#N)c(Br)c2)cc1OC |
| InChI | InChI=1S/C16H15BrN2O2/c1-20-15-6-3-11(7-16(15)21-2)10-19-13-5-4-12(9-18)14(17)8-13/h3-8,19H,10H2,1-2H3 |
| InChIKey | DSKYZXNDGOHSTM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |