C16H16FN3O2 — CID 82563008
N-[(2-fluorophenyl)methyl]-5,6-dimethoxy-1H-benzimidazol-2-amine (PubChem CID 82563008) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-5,6-dimethoxy-1H-benzimidazol-2-amine.
| Compound Name | N-[(2-fluorophenyl)methyl]-5,6-dimethoxy-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 82563008 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-5,6-dimethoxy-1H-benzimidazol-2-amine |
| SMILES | COc1cc2nc(NCc3ccccc3F)[nH]c2cc1OC |
| InChI | InChI=1S/C16H16FN3O2/c1-21-14-7-12-13(8-15(14)22-2)20-16(19-12)18-9-10-5-3-4-6-11(10)17/h3-8H,9H2,1-2H3,(H2,18,19,20) |
| InChIKey | BYRJDYOPBUNBMS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |