C14H10ClF2N3 — CID 82564403
6-chloro-N-[(2,4-difluorophenyl)methyl]-1H-benzimidazol-2-amine (PubChem CID 82564403) has the molecular formula C14H10ClF2N3 and a molecular weight of 293.70 g/mol. Its IUPAC name is 6-chloro-N-[(2,4-difluorophenyl)methyl]-1H-benzimidazol-2-amine.
| Compound Name | 6-chloro-N-[(2,4-difluorophenyl)methyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 82564403 |
| Molecular Formula | C14H10ClF2N3 |
| Molecular Weight | 293.70 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 6-chloro-N-[(2,4-difluorophenyl)methyl]-1H-benzimidazol-2-amine |
| SMILES | Fc1ccc(CNc2nc3ccc(Cl)cc3[nH]2)c(F)c1 |
| InChI | InChI=1S/C14H10ClF2N3/c15-9-2-4-12-13(5-9)20-14(19-12)18-7-8-1-3-10(16)6-11(8)17/h1-6H,7H2,(H2,18,19,20) |
| InChIKey | OLMSUBYXNUBOQJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.70 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |