C14H10BrF2N3 — CID 103294770
N-[(2-bromo-5-fluorophenyl)methyl]-6-fluoro-1H-benzimidazol-2-amine (PubChem CID 103294770) has the molecular formula C14H10BrF2N3 and a molecular weight of 338.16 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-6-fluoro-1H-benzimidazol-2-amine.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-6-fluoro-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 103294770 |
| Molecular Formula | C14H10BrF2N3 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-6-fluoro-1H-benzimidazol-2-amine |
| SMILES | Fc1ccc(Br)c(CNc2nc3ccc(F)cc3[nH]2)c1 |
| InChI | InChI=1S/C14H10BrF2N3/c15-11-3-1-9(16)5-8(11)7-18-14-19-12-4-2-10(17)6-13(12)20-14/h1-6H,7H2,(H2,18,19,20) |
| InChIKey | NPDRCVNKBKXXCL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |