C10H13FN4O2S — CID 103294870
3-[(6-fluoro-1H-benzimidazol-2-yl)amino]propane-1-sulfonamide (PubChem CID 103294870) has the molecular formula C10H13FN4O2S and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-[(6-fluoro-1H-benzimidazol-2-yl)amino]propane-1-sulfonamide.
| Compound Name | 3-[(6-fluoro-1H-benzimidazol-2-yl)amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 103294870 |
| Molecular Formula | C10H13FN4O2S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 3-[(6-fluoro-1H-benzimidazol-2-yl)amino]propane-1-sulfonamide |
| SMILES | NS(=O)(=O)CCCNc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C10H13FN4O2S/c11-7-2-3-8-9(6-7)15-10(14-8)13-4-1-5-18(12,16)17/h2-3,6H,1,4-5H2,(H2,12,16,17)(H2,13,14,15) |
| InChIKey | IXYQRMXBCFQZTJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|