C11H14FN3S — CID 103294952
6-fluoro-N-(3-methylsulfanylpropyl)-1H-benzimidazol-2-amine (PubChem CID 103294952) has the molecular formula C11H14FN3S and a molecular weight of 239.32 g/mol. Its IUPAC name is 6-fluoro-N-(3-methylsulfanylpropyl)-1H-benzimidazol-2-amine.
| Compound Name | 6-fluoro-N-(3-methylsulfanylpropyl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 103294952 |
| Molecular Formula | C11H14FN3S |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 6-fluoro-N-(3-methylsulfanylpropyl)-1H-benzimidazol-2-amine |
| SMILES | CSCCCNc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C11H14FN3S/c1-16-6-2-5-13-11-14-9-4-3-8(12)7-10(9)15-11/h3-4,7H,2,5-6H2,1H3,(H2,13,14,15) |
| InChIKey | GZGIDPMODVXPKM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|