C14H13FN4 — CID 103294739
6-fluoro-N-(2-pyridin-3-ylethyl)-1H-benzimidazol-2-amine (PubChem CID 103294739) has the molecular formula C14H13FN4 and a molecular weight of 256.28 g/mol. Its IUPAC name is 6-fluoro-N-(2-pyridin-3-ylethyl)-1H-benzimidazol-2-amine.
| Compound Name | 6-fluoro-N-(2-pyridin-3-ylethyl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 103294739 |
| Molecular Formula | C14H13FN4 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 6-fluoro-N-(2-pyridin-3-ylethyl)-1H-benzimidazol-2-amine |
| SMILES | Fc1ccc2nc(NCCc3cccnc3)[nH]c2c1 |
| InChI | InChI=1S/C14H13FN4/c15-11-3-4-12-13(8-11)19-14(18-12)17-7-5-10-2-1-6-16-9-10/h1-4,6,8-9H,5,7H2,(H2,17,18,19) |
| InChIKey | AMAALTYHIZGXPN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |