C13H12FN3S — CID 103295035
6-fluoro-N-[(3-methylthiophen-2-yl)methyl]-1H-benzimidazol-2-amine (PubChem CID 103295035) has the molecular formula C13H12FN3S and a molecular weight of 261.32 g/mol. Its IUPAC name is 6-fluoro-N-[(3-methylthiophen-2-yl)methyl]-1H-benzimidazol-2-amine.
| Compound Name | 6-fluoro-N-[(3-methylthiophen-2-yl)methyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 103295035 |
| Molecular Formula | C13H12FN3S |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 6-fluoro-N-[(3-methylthiophen-2-yl)methyl]-1H-benzimidazol-2-amine |
| SMILES | Cc1ccsc1CNc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C13H12FN3S/c1-8-4-5-18-12(8)7-15-13-16-10-3-2-9(14)6-11(10)17-13/h2-6H,7H2,1H3,(H2,15,16,17) |
| InChIKey | LDXGKASFEKYMSR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |