C14H11Cl2N3 — CID 82562708
6-chloro-N-[(4-chlorophenyl)methyl]-1H-benzimidazol-2-amine (PubChem CID 82562708) has the molecular formula C14H11Cl2N3 and a molecular weight of 292.17 g/mol. Its IUPAC name is 6-chloro-N-[(4-chlorophenyl)methyl]-1H-benzimidazol-2-amine.
| Compound Name | 6-chloro-N-[(4-chlorophenyl)methyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 82562708 |
| Molecular Formula | C14H11Cl2N3 |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 6-chloro-N-[(4-chlorophenyl)methyl]-1H-benzimidazol-2-amine |
| SMILES | Clc1ccc(CNc2nc3ccc(Cl)cc3[nH]2)cc1 |
| InChI | InChI=1S/C14H11Cl2N3/c15-10-3-1-9(2-4-10)8-17-14-18-12-6-5-11(16)7-13(12)19-14/h1-7H,8H2,(H2,17,18,19) |
| InChIKey | GCIGUQWSMDZFCE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |