C15H13F2N3 — CID 82564325
N-[(3,4-difluorophenyl)methyl]-6-methyl-1H-benzimidazol-2-amine (PubChem CID 82564325) has the molecular formula C15H13F2N3 and a molecular weight of 273.29 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-6-methyl-1H-benzimidazol-2-amine.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-6-methyl-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 82564325 |
| Molecular Formula | C15H13F2N3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-6-methyl-1H-benzimidazol-2-amine |
| SMILES | Cc1ccc2nc(NCc3ccc(F)c(F)c3)[nH]c2c1 |
| InChI | InChI=1S/C15H13F2N3/c1-9-2-5-13-14(6-9)20-15(19-13)18-8-10-3-4-11(16)12(17)7-10/h2-7H,8H2,1H3,(H2,18,19,20) |
| InChIKey | KCIXBCITKJVKKW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |