C16H15F2N3O2 — CID 82564527
N-[(3,4-difluorophenyl)methyl]-5,6-dimethoxy-1H-benzimidazol-2-amine (PubChem CID 82564527) has the molecular formula C16H15F2N3O2 and a molecular weight of 319.31 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-5,6-dimethoxy-1H-benzimidazol-2-amine.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-5,6-dimethoxy-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 82564527 |
| Molecular Formula | C16H15F2N3O2 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-5,6-dimethoxy-1H-benzimidazol-2-amine |
| SMILES | COc1cc2nc(NCc3ccc(F)c(F)c3)[nH]c2cc1OC |
| InChI | InChI=1S/C16H15F2N3O2/c1-22-14-6-12-13(7-15(14)23-2)21-16(20-12)19-8-9-3-4-10(17)11(18)5-9/h3-7H,8H2,1-2H3,(H2,19,20,21) |
| InChIKey | HFMADNZBGNUPKX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |