C15H16F2N2O2 — CID 83004452
2-N-[(3,4-difluorophenyl)methyl]-4,5-dimethoxybenzene-1,2-diamine (PubChem CID 83004452) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-N-[(3,4-difluorophenyl)methyl]-4,5-dimethoxybenzene-1,2-diamine.
| Compound Name | 2-N-[(3,4-difluorophenyl)methyl]-4,5-dimethoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 83004452 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-N-[(3,4-difluorophenyl)methyl]-4,5-dimethoxybenzene-1,2-diamine |
| SMILES | COc1cc(N)c(NCc2ccc(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C15H16F2N2O2/c1-20-14-6-12(18)13(7-15(14)21-2)19-8-9-3-4-10(16)11(17)5-9/h3-7,19H,8,18H2,1-2H3 |
| InChIKey | KUZRRQLFKYVAJI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|