C13H11F3N2 — CID 54965616
1-N-[(3,4-difluorophenyl)methyl]-4-fluorobenzene-1,2-diamine (PubChem CID 54965616) has the molecular formula C13H11F3N2 and a molecular weight of 252.24 g/mol. Its IUPAC name is 1-N-[(3,4-difluorophenyl)methyl]-4-fluorobenzene-1,2-diamine.
| Compound Name | 1-N-[(3,4-difluorophenyl)methyl]-4-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 54965616 |
| Molecular Formula | C13H11F3N2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1-N-[(3,4-difluorophenyl)methyl]-4-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(F)ccc1NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H11F3N2/c14-9-2-4-13(12(17)6-9)18-7-8-1-3-10(15)11(16)5-8/h1-6,18H,7,17H2 |
| InChIKey | VWFICMWNCSIBKO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|