C14H13ClF2N2 — CID 115554741
2-chloro-4-N-[(3,4-difluorophenyl)methyl]-5-methylbenzene-1,4-diamine (PubChem CID 115554741) has the molecular formula C14H13ClF2N2 and a molecular weight of 282.72 g/mol. Its IUPAC name is 2-chloro-4-N-[(3,4-difluorophenyl)methyl]-5-methylbenzene-1,4-diamine.
| Compound Name | 2-chloro-4-N-[(3,4-difluorophenyl)methyl]-5-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 115554741 |
| Molecular Formula | C14H13ClF2N2 |
| Molecular Weight | 282.72 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-chloro-4-N-[(3,4-difluorophenyl)methyl]-5-methylbenzene-1,4-diamine |
| SMILES | Cc1cc(N)c(Cl)cc1NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H13ClF2N2/c1-8-4-13(18)10(15)6-14(8)19-7-9-2-3-11(16)12(17)5-9/h2-6,19H,7,18H2,1H3 |
| InChIKey | ZKQDLQNZEWNJGR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.72 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|