C13H10F3IN2 — CID 66102255
2-N-[(3,4-difluorophenyl)methyl]-4-fluoro-5-iodobenzene-1,2-diamine (PubChem CID 66102255) has the molecular formula C13H10F3IN2 and a molecular weight of 378.14 g/mol. Its IUPAC name is 2-N-[(3,4-difluorophenyl)methyl]-4-fluoro-5-iodobenzene-1,2-diamine.
| Compound Name | 2-N-[(3,4-difluorophenyl)methyl]-4-fluoro-5-iodobenzene-1,2-diamine |
|---|---|
| PubChem CID | 66102255 |
| Molecular Formula | C13H10F3IN2 |
| Molecular Weight | 378.14 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 2-N-[(3,4-difluorophenyl)methyl]-4-fluoro-5-iodobenzene-1,2-diamine |
| SMILES | Nc1cc(I)c(F)cc1NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H10F3IN2/c14-8-2-1-7(3-9(8)15)6-19-13-4-10(16)11(17)5-12(13)18/h1-5,19H,6,18H2 |
| InChIKey | XQJVRQDCGUEJGW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.14 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|