C13H13FIN3O — CID 66100905
4-fluoro-5-iodo-2-N-[(2-methoxy-4-pyridinyl)methyl]benzene-1,2-diamine (PubChem CID 66100905) has the molecular formula C13H13FIN3O and a molecular weight of 373.17 g/mol. Its IUPAC name is 4-fluoro-5-iodo-2-N-[(2-methoxy-4-pyridinyl)methyl]benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-iodo-2-N-[(2-methoxy-4-pyridinyl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 66100905 |
| Molecular Formula | C13H13FIN3O |
| Molecular Weight | 373.17 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 4-fluoro-5-iodo-2-N-[(2-methoxy-4-pyridinyl)methyl]benzene-1,2-diamine |
| SMILES | COc1cc(CNc2cc(F)c(I)cc2N)ccn1 |
| InChI | InChI=1S/C13H13FIN3O/c1-19-13-4-8(2-3-17-13)7-18-12-5-9(14)10(15)6-11(12)16/h2-6,18H,7,16H2,1H3 |
| InChIKey | GCQDVFBZZKMPOC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|