C14H14FN3O3 — CID 83207084
2-amino-3-fluoro-6-[(2-methoxy-4-pyridinyl)methylamino]benzoic acid (PubChem CID 83207084) has the molecular formula C14H14FN3O3 and a molecular weight of 291.28 g/mol. Its IUPAC name is 2-amino-3-fluoro-6-[(2-methoxy-4-pyridinyl)methylamino]benzoic acid.
| Compound Name | 2-amino-3-fluoro-6-[(2-methoxy-4-pyridinyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 83207084 |
| Molecular Formula | C14H14FN3O3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-amino-3-fluoro-6-[(2-methoxy-4-pyridinyl)methylamino]benzoic acid |
| SMILES | COc1cc(CNc2ccc(F)c(N)c2C(=O)O)ccn1 |
| InChI | InChI=1S/C14H14FN3O3/c1-21-11-6-8(4-5-17-11)7-18-10-3-2-9(15)13(16)12(10)14(19)20/h2-6,18H,7,16H2,1H3,(H,19,20) |
| InChIKey | HFTVAVWBFPMIKN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|