C13H14BrN3O — CID 65342517
4-bromo-2-N-[(2-methoxy-4-pyridinyl)methyl]benzene-1,2-diamine (PubChem CID 65342517) has the molecular formula C13H14BrN3O and a molecular weight of 308.18 g/mol. Its IUPAC name is 4-bromo-2-N-[(2-methoxy-4-pyridinyl)methyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-[(2-methoxy-4-pyridinyl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 65342517 |
| Molecular Formula | C13H14BrN3O |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 4-bromo-2-N-[(2-methoxy-4-pyridinyl)methyl]benzene-1,2-diamine |
| SMILES | COc1cc(CNc2cc(Br)ccc2N)ccn1 |
| InChI | InChI=1S/C13H14BrN3O/c1-18-13-6-9(4-5-16-13)8-17-12-7-10(14)2-3-11(12)15/h2-7,17H,8,15H2,1H3 |
| InChIKey | JFBTWIDULXLKTG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|