C10H9FIN3O — CID 106414559
4-fluoro-5-iodo-2-N-(1,2-oxazol-5-ylmethyl)benzene-1,2-diamine (PubChem CID 106414559) has the molecular formula C10H9FIN3O and a molecular weight of 333.10 g/mol. Its IUPAC name is 4-fluoro-5-iodo-2-N-(1,2-oxazol-5-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-iodo-2-N-(1,2-oxazol-5-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 106414559 |
| Molecular Formula | C10H9FIN3O |
| Molecular Weight | 333.10 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 4-fluoro-5-iodo-2-N-(1,2-oxazol-5-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1cc(I)c(F)cc1NCc1ccno1 |
| InChI | InChI=1S/C10H9FIN3O/c11-7-3-10(9(13)4-8(7)12)14-5-6-1-2-15-16-6/h1-4,14H,5,13H2 |
| InChIKey | VRHBZFRXQFCNKJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.10 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|