C11H11FIN3O — CID 66100103
4-fluoro-5-iodo-2-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzene-1,2-diamine (PubChem CID 66100103) has the molecular formula C11H11FIN3O and a molecular weight of 347.13 g/mol. Its IUPAC name is 4-fluoro-5-iodo-2-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-iodo-2-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 66100103 |
| Molecular Formula | C11H11FIN3O |
| Molecular Weight | 347.13 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 4-fluoro-5-iodo-2-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzene-1,2-diamine |
| SMILES | Cc1cc(CNc2cc(F)c(I)cc2N)no1 |
| InChI | InChI=1S/C11H11FIN3O/c1-6-2-7(16-17-6)5-15-11-3-8(12)9(13)4-10(11)14/h2-4,15H,5,14H2,1H3 |
| InChIKey | WTFMQRJBTZWKTB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.13 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|