C12H18FIN2 — CID 66101509
2-N-(2,3-dimethylbutyl)-4-fluoro-5-iodobenzene-1,2-diamine (PubChem CID 66101509) has the molecular formula C12H18FIN2 and a molecular weight of 336.19 g/mol. Its IUPAC name is 2-N-(2,3-dimethylbutyl)-4-fluoro-5-iodobenzene-1,2-diamine.
| Compound Name | 2-N-(2,3-dimethylbutyl)-4-fluoro-5-iodobenzene-1,2-diamine |
|---|---|
| PubChem CID | 66101509 |
| Molecular Formula | C12H18FIN2 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-N-(2,3-dimethylbutyl)-4-fluoro-5-iodobenzene-1,2-diamine |
| SMILES | CC(C)C(C)CNc1cc(F)c(I)cc1N |
| InChI | InChI=1S/C12H18FIN2/c1-7(2)8(3)6-16-12-4-9(13)10(14)5-11(12)15/h4-5,7-8,16H,6,15H2,1-3H3 |
| InChIKey | HLNHSDLFVKIZED-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|