C12H19ClN2 — CID 115469039
4-chloro-2-N-(2,3-dimethylbutyl)benzene-1,2-diamine (PubChem CID 115469039) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is 4-chloro-2-N-(2,3-dimethylbutyl)benzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-(2,3-dimethylbutyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115469039 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 4-chloro-2-N-(2,3-dimethylbutyl)benzene-1,2-diamine |
| SMILES | CC(C)C(C)CNc1cc(Cl)ccc1N |
| InChI | InChI=1S/C12H19ClN2/c1-8(2)9(3)7-15-12-6-10(13)4-5-11(12)14/h4-6,8-9,15H,7,14H2,1-3H3 |
| InChIKey | FTPOQFLXMKFFSH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|