C13H21ClN2O — CID 113315721
4-chloro-2-N-[2-(3-methylbutoxy)ethyl]benzene-1,2-diamine (PubChem CID 113315721) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 4-chloro-2-N-[2-(3-methylbutoxy)ethyl]benzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-[2-(3-methylbutoxy)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 113315721 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 4-chloro-2-N-[2-(3-methylbutoxy)ethyl]benzene-1,2-diamine |
| SMILES | CC(C)CCOCCNc1cc(Cl)ccc1N |
| InChI | InChI=1S/C13H21ClN2O/c1-10(2)5-7-17-8-6-16-13-9-11(14)3-4-12(13)15/h3-4,9-10,16H,5-8,15H2,1-2H3 |
| InChIKey | ZAVGUSMKDPDQNA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|