C18H31N3O3 — CID 114199911
tert-butyl N-[4-amino-3-[2-(3-methylbutoxy)ethylamino]phenyl]carbamate (PubChem CID 114199911) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-[2-(3-methylbutoxy)ethylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-[2-(3-methylbutoxy)ethylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 114199911 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | tert-butyl N-[4-amino-3-[2-(3-methylbutoxy)ethylamino]phenyl]carbamate |
| SMILES | CC(C)CCOCCNc1cc(NC(=O)OC(C)(C)C)ccc1N |
| InChI | InChI=1S/C18H31N3O3/c1-13(2)8-10-23-11-9-20-16-12-14(6-7-15(16)19)21-17(22)24-18(3,4)5/h6-7,12-13,20H,8-11,19H2,1-5H3,(H,21,22) |
| InChIKey | RMSDNEAECFWLPE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|