C14H23N3O2S — CID 59345536
tert-butyl N-[2-(2-amino-5-methylsulfanylanilino)ethyl]carbamate (PubChem CID 59345536) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is tert-butyl N-[2-(2-amino-5-methylsulfanylanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-amino-5-methylsulfanylanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 59345536 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | tert-butyl N-[2-(2-amino-5-methylsulfanylanilino)ethyl]carbamate |
| SMILES | CSc1ccc(N)c(NCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C14H23N3O2S/c1-14(2,3)19-13(18)17-8-7-16-12-9-10(20-4)5-6-11(12)15/h5-6,9,16H,7-8,15H2,1-4H3,(H,17,18) |
| InChIKey | SJPVXKKXPSCUQJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|