C14H21N3O3S — CID 129309383
tert-butyl N-[2-(5-methylsulfanyl-2-nitrosoanilino)ethyl]carbamate (PubChem CID 129309383) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is tert-butyl N-[2-(5-methylsulfanyl-2-nitrosoanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(5-methylsulfanyl-2-nitrosoanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 129309383 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | tert-butyl N-[2-(5-methylsulfanyl-2-nitrosoanilino)ethyl]carbamate |
| SMILES | CSc1ccc(N=O)c(NCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C14H21N3O3S/c1-14(2,3)20-13(18)16-8-7-15-12-9-10(21-4)5-6-11(12)17-19/h5-6,9,15H,7-8H2,1-4H3,(H,16,18) |
| InChIKey | YCYJOHIPUTZKAG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|