C14H18F3N5O2 — CID 169324862
tert-butyl N-[2-[2-azido-4-(trifluoromethyl)anilino]ethyl]carbamate (PubChem CID 169324862) has the molecular formula C14H18F3N5O2 and a molecular weight of 345.33 g/mol. Its IUPAC name is tert-butyl N-[2-[2-azido-4-(trifluoromethyl)anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-azido-4-(trifluoromethyl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 169324862 |
| Molecular Formula | C14H18F3N5O2 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | tert-butyl N-[2-[2-azido-4-(trifluoromethyl)anilino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc(C(F)(F)F)cc1N=[N+]=[N-] |
| InChI | InChI=1S/C14H18F3N5O2/c1-13(2,3)24-12(23)20-7-6-19-10-5-4-9(14(15,16)17)8-11(10)21-22-18/h4-5,8,19H,6-7H2,1-3H3,(H,20,23) |
| InChIKey | VJWCVCWCDLTWBD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|