C18H22ClF3N4O2S — CID 168579926
tert-butyl N-[2-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-(trifluoromethyl)anilino]ethyl]carbamate (PubChem CID 168579926) has the molecular formula C18H22ClF3N4O2S and a molecular weight of 450.91 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-(trifluoromethyl)anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-(trifluoromethyl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 168579926 |
| Molecular Formula | C18H22ClF3N4O2S |
| Molecular Weight | 450.91 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | tert-butyl N-[2-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-4-(trifluoromethyl)anilino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc(C(F)(F)F)cc1NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C18H22ClF3N4O2S/c1-17(2,3)28-16(27)24-7-6-23-13-5-4-11(18(20,21)22)8-14(13)25-9-12-10-26-15(19)29-12/h4-5,8,10,23,25H,6-7,9H2,1-3H3,(H,24,27) |
| InChIKey | AZFFYFVLLNJPAC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.91 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|