C13H19ClFN3O2 — CID 114517992
tert-butyl N-[2-(2-amino-4-chloro-5-fluoroanilino)ethyl]carbamate (PubChem CID 114517992) has the molecular formula C13H19ClFN3O2 and a molecular weight of 303.76 g/mol. Its IUPAC name is tert-butyl N-[2-(2-amino-4-chloro-5-fluoroanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-amino-4-chloro-5-fluoroanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 114517992 |
| Molecular Formula | C13H19ClFN3O2 |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | tert-butyl N-[2-(2-amino-4-chloro-5-fluoroanilino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1cc(F)c(Cl)cc1N |
| InChI | InChI=1S/C13H19ClFN3O2/c1-13(2,3)20-12(19)18-5-4-17-11-7-9(15)8(14)6-10(11)16/h6-7,17H,4-5,16H2,1-3H3,(H,18,19) |
| InChIKey | YNANAMKFBUKQPD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|