C12H18ClFN2O2 — CID 114097566
4-chloro-5-fluoro-1-N-[3-(2-methoxyethoxy)propyl]benzene-1,2-diamine (PubChem CID 114097566) has the molecular formula C12H18ClFN2O2 and a molecular weight of 276.74 g/mol. Its IUPAC name is 4-chloro-5-fluoro-1-N-[3-(2-methoxyethoxy)propyl]benzene-1,2-diamine.
| Compound Name | 4-chloro-5-fluoro-1-N-[3-(2-methoxyethoxy)propyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 114097566 |
| Molecular Formula | C12H18ClFN2O2 |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-chloro-5-fluoro-1-N-[3-(2-methoxyethoxy)propyl]benzene-1,2-diamine |
| SMILES | COCCOCCCNc1cc(F)c(Cl)cc1N |
| InChI | InChI=1S/C12H18ClFN2O2/c1-17-5-6-18-4-2-3-16-12-8-10(14)9(13)7-11(12)15/h7-8,16H,2-6,15H2,1H3 |
| InChIKey | UMUXTWVFVNEFFH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|