C14H23ClFN3 — CID 66077440
4-chloro-5-fluoro-1-N-[4-[methyl(propan-2-yl)amino]butyl]benzene-1,2-diamine (PubChem CID 66077440) has the molecular formula C14H23ClFN3 and a molecular weight of 287.81 g/mol. Its IUPAC name is 4-chloro-5-fluoro-1-N-[4-[methyl(propan-2-yl)amino]butyl]benzene-1,2-diamine.
| Compound Name | 4-chloro-5-fluoro-1-N-[4-[methyl(propan-2-yl)amino]butyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 66077440 |
| Molecular Formula | C14H23ClFN3 |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-chloro-5-fluoro-1-N-[4-[methyl(propan-2-yl)amino]butyl]benzene-1,2-diamine |
| SMILES | CC(C)N(C)CCCCNc1cc(F)c(Cl)cc1N |
| InChI | InChI=1S/C14H23ClFN3/c1-10(2)19(3)7-5-4-6-18-14-9-12(16)11(15)8-13(14)17/h8-10,18H,4-7,17H2,1-3H3 |
| InChIKey | DOBXILNOFCUPSR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|