C15H24BrFN2 — CID 107814758
4-bromo-5-fluoro-1-N-(7-methyloctyl)benzene-1,2-diamine (PubChem CID 107814758) has the molecular formula C15H24BrFN2 and a molecular weight of 331.27 g/mol. Its IUPAC name is 4-bromo-5-fluoro-1-N-(7-methyloctyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-5-fluoro-1-N-(7-methyloctyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 107814758 |
| Molecular Formula | C15H24BrFN2 |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 4-bromo-5-fluoro-1-N-(7-methyloctyl)benzene-1,2-diamine |
| SMILES | CC(C)CCCCCCNc1cc(F)c(Br)cc1N |
| InChI | InChI=1S/C15H24BrFN2/c1-11(2)7-5-3-4-6-8-19-15-10-13(17)12(16)9-14(15)18/h9-11,19H,3-8,18H2,1-2H3 |
| InChIKey | LFBZJTBJXNWIBR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|