C11H16BrFN2O — CID 104758724
4-bromo-5-fluoro-1-N-(2-propan-2-yloxyethyl)benzene-1,2-diamine (PubChem CID 104758724) has the molecular formula C11H16BrFN2O and a molecular weight of 291.16 g/mol. Its IUPAC name is 4-bromo-5-fluoro-1-N-(2-propan-2-yloxyethyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-5-fluoro-1-N-(2-propan-2-yloxyethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 104758724 |
| Molecular Formula | C11H16BrFN2O |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-bromo-5-fluoro-1-N-(2-propan-2-yloxyethyl)benzene-1,2-diamine |
| SMILES | CC(C)OCCNc1cc(F)c(Br)cc1N |
| InChI | InChI=1S/C11H16BrFN2O/c1-7(2)16-4-3-15-11-6-9(13)8(12)5-10(11)14/h5-7,15H,3-4,14H2,1-2H3 |
| InChIKey | OOHKEDOWAGSFOL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|