C13H23BrN2O — CID 145256343
4-bromo-2-N-(2-propan-2-yloxyethyl)benzene-1,2-diamine;ethane (PubChem CID 145256343) has the molecular formula C13H23BrN2O and a molecular weight of 303.24 g/mol. Its IUPAC name is 4-bromo-2-N-(2-propan-2-yloxyethyl)benzene-1,2-diamine;ethane.
| Compound Name | 4-bromo-2-N-(2-propan-2-yloxyethyl)benzene-1,2-diamine;ethane |
|---|---|
| PubChem CID | 145256343 |
| Molecular Formula | C13H23BrN2O |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 4-bromo-2-N-(2-propan-2-yloxyethyl)benzene-1,2-diamine;ethane |
| SMILES | CC.CC(C)OCCNc1cc(Br)ccc1N |
| InChI | InChI=1S/C11H17BrN2O.C2H6/c1-8(2)15-6-5-14-11-7-9(12)3-4-10(11)13;1-2/h3-4,7-8,14H,5-6,13H2,1-2H3;1-2H3 |
| InChIKey | HZHSQVWJONXPEI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|