C13H19BrN2O — CID 65342141
4-bromo-2-N-(2-cyclopentyloxyethyl)benzene-1,2-diamine (PubChem CID 65342141) has the molecular formula C13H19BrN2O and a molecular weight of 299.21 g/mol. Its IUPAC name is 4-bromo-2-N-(2-cyclopentyloxyethyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-(2-cyclopentyloxyethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 65342141 |
| Molecular Formula | C13H19BrN2O |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 4-bromo-2-N-(2-cyclopentyloxyethyl)benzene-1,2-diamine |
| SMILES | Nc1ccc(Br)cc1NCCOC1CCCC1 |
| InChI | InChI=1S/C13H19BrN2O/c14-10-5-6-12(15)13(9-10)16-7-8-17-11-3-1-2-4-11/h5-6,9,11,16H,1-4,7-8,15H2 |
| InChIKey | BENOMCFRAGBAFV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|