C10H15BrN2O — CID 65343412
4-bromo-2-N-(3-methoxypropyl)benzene-1,2-diamine (PubChem CID 65343412) has the molecular formula C10H15BrN2O and a molecular weight of 259.15 g/mol. Its IUPAC name is 4-bromo-2-N-(3-methoxypropyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-(3-methoxypropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 65343412 |
| Molecular Formula | C10H15BrN2O |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 4-bromo-2-N-(3-methoxypropyl)benzene-1,2-diamine |
| SMILES | COCCCNc1cc(Br)ccc1N |
| InChI | InChI=1S/C10H15BrN2O/c1-14-6-2-5-13-10-7-8(11)3-4-9(10)12/h3-4,7,13H,2,5-6,12H2,1H3 |
| InChIKey | ORHYZXYDEJCEKJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|