C12H20BrN3O — CID 65342624
4-bromo-2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzene-1,2-diamine (PubChem CID 65342624) has the molecular formula C12H20BrN3O and a molecular weight of 302.22 g/mol. Its IUPAC name is 4-bromo-2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 65342624 |
| Molecular Formula | C12H20BrN3O |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 4-bromo-2-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzene-1,2-diamine |
| SMILES | COCCN(C)CCNc1cc(Br)ccc1N |
| InChI | InChI=1S/C12H20BrN3O/c1-16(7-8-17-2)6-5-15-12-9-10(13)3-4-11(12)14/h3-4,9,15H,5-8,14H2,1-2H3 |
| InChIKey | RJGYGSYOQZCYGL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|