C12H18BrN3O3 — CID 55130087
N-(4-bromo-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine (PubChem CID 55130087) has the molecular formula C12H18BrN3O3 and a molecular weight of 332.20 g/mol. Its IUPAC name is N-(4-bromo-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N-(4-bromo-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 55130087 |
| Molecular Formula | C12H18BrN3O3 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-(4-bromo-2-nitrophenyl)-N'-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| SMILES | COCCN(C)CCNc1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18BrN3O3/c1-15(7-8-19-2)6-5-14-11-4-3-10(13)9-12(11)16(17)18/h3-4,9,14H,5-8H2,1-2H3 |
| InChIKey | ZFPRZEMTLIMQHD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|