C12H17BrN2O4 — CID 60647488
4-bromo-N,N-bis(2-methoxyethyl)-2-nitroaniline (PubChem CID 60647488) has the molecular formula C12H17BrN2O4 and a molecular weight of 333.18 g/mol. Its IUPAC name is 4-bromo-N,N-bis(2-methoxyethyl)-2-nitroaniline.
| Compound Name | 4-bromo-N,N-bis(2-methoxyethyl)-2-nitroaniline |
|---|---|
| PubChem CID | 60647488 |
| Molecular Formula | C12H17BrN2O4 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 4-bromo-N,N-bis(2-methoxyethyl)-2-nitroaniline |
| SMILES | COCCN(CCOC)c1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17BrN2O4/c1-18-7-5-14(6-8-19-2)11-4-3-10(13)9-12(11)15(16)17/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | DORHWRURYOSXHR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|