C14H22BrN3O2 — CID 63462031
N'-(4-bromo-2-nitrophenyl)-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 63462031) has the molecular formula C14H22BrN3O2 and a molecular weight of 344.25 g/mol. Its IUPAC name is N'-(4-bromo-2-nitrophenyl)-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N'-(4-bromo-2-nitrophenyl)-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 63462031 |
| Molecular Formula | C14H22BrN3O2 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N'-(4-bromo-2-nitrophenyl)-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CN(CCN(C)C)c1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H22BrN3O2/c1-11(2)10-17(8-7-16(3)4)13-6-5-12(15)9-14(13)18(19)20/h5-6,9,11H,7-8,10H2,1-4H3 |
| InChIKey | NBYQMHPYUGMWFS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|