C15H21BrN2O3S — CID 145351291
N-(4-bromo-2-nitrophenyl)-N-(2-methylpropyl)-1-oxothian-4-amine (PubChem CID 145351291) has the molecular formula C15H21BrN2O3S and a molecular weight of 389.32 g/mol. Its IUPAC name is N-(4-bromo-2-nitrophenyl)-N-(2-methylpropyl)-1-oxothian-4-amine.
| Compound Name | N-(4-bromo-2-nitrophenyl)-N-(2-methylpropyl)-1-oxothian-4-amine |
|---|---|
| PubChem CID | 145351291 |
| Molecular Formula | C15H21BrN2O3S |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | N-(4-bromo-2-nitrophenyl)-N-(2-methylpropyl)-1-oxothian-4-amine |
| SMILES | CC(C)CN(c1ccc(Br)cc1[N+](=O)[O-])C1CCS(=O)CC1 |
| InChI | InChI=1S/C15H21BrN2O3S/c1-11(2)10-17(13-5-7-22(21)8-6-13)14-4-3-12(16)9-15(14)18(19)20/h3-4,9,11,13H,5-8,10H2,1-2H3 |
| InChIKey | HSNPAVBEWRPJJK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|