C17H23BrN2O2 — CID 118676164
(1R,2R,4S)-N-(4-bromo-2-nitrophenyl)-N-(2-methylpropyl)bicyclo[2.2.1]heptan-2-amine (PubChem CID 118676164) has the molecular formula C17H23BrN2O2 and a molecular weight of 367.29 g/mol. Its IUPAC name is (1R,2R,4S)-N-(4-bromo-2-nitrophenyl)-N-(2-methylpropyl)bicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,2R,4S)-N-(4-bromo-2-nitrophenyl)-N-(2-methylpropyl)bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 118676164 |
| Molecular Formula | C17H23BrN2O2 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (1R,2R,4S)-N-(4-bromo-2-nitrophenyl)-N-(2-methylpropyl)bicyclo[2.2.1]heptan-2-amine |
| SMILES | CC(C)CN(c1ccc(Br)cc1[N+](=O)[O-])[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C17H23BrN2O2/c1-11(2)10-19(16-8-12-3-4-13(16)7-12)15-6-5-14(18)9-17(15)20(21)22/h5-6,9,11-13,16H,3-4,7-8,10H2,1-2H3/t12-,13+,16+/m0/s1 |
| InChIKey | AUNMNPDXACPYSI-WOSRLPQWSA-N |
| XLogP | 5.01 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|