C13H17BrN2O2 — CID 63463503
4-bromo-N-cyclopropyl-N-(2-methylpropyl)-2-nitroaniline (PubChem CID 63463503) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. Its IUPAC name is 4-bromo-N-cyclopropyl-N-(2-methylpropyl)-2-nitroaniline.
| Compound Name | 4-bromo-N-cyclopropyl-N-(2-methylpropyl)-2-nitroaniline |
|---|---|
| PubChem CID | 63463503 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 4-bromo-N-cyclopropyl-N-(2-methylpropyl)-2-nitroaniline |
| SMILES | CC(C)CN(c1ccc(Br)cc1[N+](=O)[O-])C1CC1 |
| InChI | InChI=1S/C13H17BrN2O2/c1-9(2)8-15(11-4-5-11)12-6-3-10(14)7-13(12)16(17)18/h3,6-7,9,11H,4-5,8H2,1-2H3 |
| InChIKey | QCEHSLMJTDDGOG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|