C11H16N2O3 — CID 143918275
N-(2-methoxyethyl)-N,4-dimethyl-2-nitroaniline (PubChem CID 143918275) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N,4-dimethyl-2-nitroaniline.
| Compound Name | N-(2-methoxyethyl)-N,4-dimethyl-2-nitroaniline |
|---|---|
| PubChem CID | 143918275 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | N-(2-methoxyethyl)-N,4-dimethyl-2-nitroaniline |
| SMILES | COCCN(C)c1ccc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N2O3/c1-9-4-5-10(11(8-9)13(14)15)12(2)6-7-16-3/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | WRDIRTQUBBQRLA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|