C13H21BrN2O2 — CID 61418446
2-(aminomethyl)-5-bromo-N,N-bis(2-methoxyethyl)aniline (PubChem CID 61418446) has the molecular formula C13H21BrN2O2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 2-(aminomethyl)-5-bromo-N,N-bis(2-methoxyethyl)aniline.
| Compound Name | 2-(aminomethyl)-5-bromo-N,N-bis(2-methoxyethyl)aniline |
|---|---|
| PubChem CID | 61418446 |
| Molecular Formula | C13H21BrN2O2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2-(aminomethyl)-5-bromo-N,N-bis(2-methoxyethyl)aniline |
| SMILES | COCCN(CCOC)c1cc(Br)ccc1CN |
| InChI | InChI=1S/C13H21BrN2O2/c1-17-7-5-16(6-8-18-2)13-9-12(14)4-3-11(13)10-15/h3-4,9H,5-8,10,15H2,1-2H3 |
| InChIKey | BWXSDURULJQOBE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |